M7434258
(S)-SNAP5114 , ≥98% , 157604-55-2
Synonym(s):
(S)-1-[2-[Tris(4-methoxyphenyl)methoxy]ethyl]-3-piperidinecarboxylic acid
| Pack Size | Price | Stock | Quantity |
| 5g | RMB5248.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 643.9±55.0 °C(Predicted) |
| Density | 1.175±0.06 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | H2O: insoluble |
| form | solid |
| pka | 3.85±0.20(Predicted) |
| color | white |
| optical activity | [α]/D -8 to -13°, c =1 in chloroform-d |
| InChIKey | VDLDUZLDZBVOAS-QFIPXVFZSA-N |
| SMILES | COc1ccc(cc1)C(OCCN2CCC[C@@H](C2)C(O)=O)(c3ccc(OC)cc3)c4ccc(OC)cc4 |
Description and Uses
(S)-SNAP 5114 is a GABA, GAT3 inhibitor.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
