M7943747
LY83583 , 98% , 91300-60-6
Synonym(s):
6-(Phenylamino)-5,8-quinolinedione;6-Anilino-5,8-quinolinequinone;LY 83583 - CAS 91300-60-6 - Calbiochem;LY-83,583;LY83583
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB1476.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 184-185°C |
| Boiling point: | 446.9±45.0 °C(Predicted) |
| Density | 1.400±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | 0.1 M HCl: 1 mg/mL |
| form | solid |
| pka | -0.63±0.20(Predicted) |
| color | violet |
| InChI | 1S/C15H10N2O2/c18-13-9-12(17-10-5-2-1-3-6-10)15(19)11-7-4-8-16-14(11)13/h1-9,17H |
| InChIKey | GXIJYWUWLNHKNW-UHFFFAOYSA-N |
| SMILES | O=C1C=C(Nc2ccccc2)C(=O)c3cccnc13 |
| CAS DataBase Reference | 91300-60-6(CAS DataBase Reference) |
Description and Uses
Inhibits nitric-oxide-induced activation of soluble guanylate cyclase (IC50=2μM) in a dose-dependent and reversible manner. It blocks acetylcholine induced vasorelaxation. Also an inhibitor of antigen-induced leukotriene release.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280-P271 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 40-36/37/38 |
| Safety Statements | 36/37-36-26 |
| WGK Germany | 2 |
| HS Code | 2933499090 |
| Storage Class | 11 - Combustible Solids |






