M7973047
OctanoicAcid-d3(CaprylicAcid-d3) , 98% , 156779-05-4
Synonym(s):
Caprylic acid-8,8,8-d3
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB2172.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 16 °C(lit.) |
| Boiling point: | 237 °C(lit.) |
| Density | 0.929 g/mL at 25 °C |
| Flash point: | 110 °C |
| storage temp. | Store at -20°C |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 30 mg/ml |
| form | A liquid |
| color | Colorless to light yellow |
| InChI | 1S/C8H16O2/c1-2-3-4-5-6-7-8(9)10/h2-7H2,1H3,(H,9,10)/i1D3 |
| InChIKey | WWZKQHOCKIZLMA-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CCCCCCC(O)=O |
Description and Uses
Octanoic-8,8,8-d3 Acid (CAS# 156779-05-4) is a useful isotopically labeled research compound.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P264-P280-P301+P330+P331-P303+P361+P353-P363-P304+P340-P310-P321-P305+P351+P338-P405-P501 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/39-45 |
| RIDADR | UN 3265 8/PG 3 |
| WGK Germany | WGK 1 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
