PRODUCT Properties
| Melting point: | 118-120°C |
| Boiling point: | 481.0±45.0 °C(Predicted) |
| Density | 1.574±0.06 g/cm3(Predicted) |
| storage temp. | Hygroscopic, Store under Inert atmosphere -20°C Freezer |
| solubility | Methanol (Slightly), Water (Slightly) |
| pka | 11.33±0.20(Predicted) |
| form | Solid |
| color | Off-White to Dark Yellow |
| Stability: | Hygroscopic |
| InChI | 1S/C6H10O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,4-6,8,10-12H,2H2/t4-,5-,6-/m1/s1 |
| InChIKey | DCNMIDLYWOTSGK-HSUXUTPPSA-N |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)C(=O)C=O |
| CAS DataBase Reference | 1854-25-7 |
Description and Uses
2-Keto-D-glucose is a useful synthetic intermediate.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29144000 |
| Storage Class | 11 - Combustible Solids |
