M8026947
C-6NBD , 98% , 88235-25-0
Synonym(s):
6-(7-Nitro-2,1,3-benzoxadiazol-4-ylamino)hexanoic acid
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB3553.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 152 - 154°C |
| Boiling point: | 559.4±60.0 °C(Predicted) |
| Density | 1.462 |
| storage temp. | 2-8°C(protect from light) |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.74±0.10(Predicted) |
| color | Very Dark Orange |
| BRN | 6936249 |
| InChI | 1S/C12H14N4O5/c17-10(18)4-2-1-3-7-13-8-5-6-9(16(19)20)12-11(8)14-21-15-12/h5-6,13H,1-4,7H2,(H,17,18) |
| InChIKey | DJFNQJJTTPMBIL-UHFFFAOYSA-N |
| SMILES | OC(=O)CCCCCNc1ccc([N+]([O-])=O)c2nonc12 |
Description and Uses
NBD Hexanoic Acid is used as a fluorescent probes for studying the fat globule (membrane) of bovine and human.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P310-P302+P352+P312-P304+P340+P311-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 23/24/25-36/37/38 |
| Safety Statements | 22-26-36-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| F | 8 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



