M8059747
Opipramol , ≥98% , 315-72-0
Synonym(s):
4-[3-(5H-Dibenz[b,f]azepin-5-yl)-propyl]-1-piperazineethanol;NSC 169867
CAS NO.:315-72-0
Empirical Formula: C23H29N3O
Molecular Weight: 363.5
MDL number: MFCD00865455
EINECS: 206-254-0
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB1605.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 100-1010C |
| Boiling point: | 494.88°C (rough estimate) |
| Density | 1.0920 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| storage temp. | -20°C Freezer |
| solubility | Acetonitrile: slightly soluble; Chloroform: slightly soluble; Methanol: slightly soluble |
| pka | pKa 8(H2O,t =25,I=0.01(NaCl)) (Uncertain) |
| form | Solid |
| color | Light yellow to yellow |
| BRN | 627076 |
| Major Application | forensics and toxicology veterinary |
| InChI | 1S/C23H29N3O/c27-19-18-25-16-14-24(15-17-25)12-5-13-26-22-8-3-1-6-20(22)10-11-21-7-2-4-9-23(21)26/h1-4,6-11,27H,5,12-19H2 |
| InChIKey | YNZFUWZUGRBMHL-UHFFFAOYSA-N |
| SMILES | OCCN(CC1)CCN1CCCN2C(C=CC=C3)=C3C=CC4=C2C=CC=C4 |
Description and Uses
Antidepressant; antipsychotic
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H410 |
| Precautionary statements | P273-P501 |
| Hazard Codes | Xn,N |
| Risk Statements | 22-50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 1 |
| RTECS | TL8750000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| REACH Registrations | Active |





