PRODUCT Properties
| Melting point: | 228 °C |
| Boiling point: | 260-275 °C(Press: 2 Torr) |
| Density | 1.1679 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | pKa 8.1(H2O,t =24±1,I undefined) (Uncertain) |
| color | White to Yellow |
| Water Solubility | 14.96mg/L(24 ºC) |
| BCS Class | 2 |
| InChI | InChI=1S/C20H24ClN3S/c1-22-11-13-23(14-12-22)9-4-10-24-17-5-2-3-6-19(17)25-20-8-7-16(21)15-18(20)24/h2-3,5-8,15H,4,9-14H2,1H3 |
| InChIKey | WIKYUJGCLQQFNW-UHFFFAOYSA-N |
| SMILES | C1=C2C(SC3=C(N2CCCN2CCN(C)CC2)C=CC=C3)=CC=C1Cl |
| CAS DataBase Reference | 58-38-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Prochlorperazine(58-38-8) |
Description and Uses
antiemetic, antipsychotic, treatment of vertigo
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H336-H361d-H362 |
| Precautionary statements | P201-P260-P263-P301+P312+P330-P308+P313 |
| target organs | Central nervous system |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Lact. Repr. 2 STOT SE 3 |
| Hazardous Substances Data | 58-38-8(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: 1800mg/kg |







