PRODUCT Properties
| Melting point: | 30-32° |
| Boiling point: | 658.1±55.0 °C(Predicted) |
| Density | 1.149±0.06 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | Practically insoluble in water, very soluble in ethanol and in methylene chloride, freely soluble in methanol. |
| form | Oil |
| pka | 7.32±0.10(Predicted) |
| color | Light yellow to yellow |
| Major Application | pharmaceutical (small molecule) |
| InChIKey | VIQCGTZFEYDQMR-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cc2c(cc1)Sc3c(cccc3)N2CCCN4CCN(CC4)CCOC(=O)CCCCCCCCC |
| CAS DataBase Reference | 5002-47-1 |
Description and Uses
Fluphenazine Decanoate is used in psychotropic drug treatments like those relating to schizophrenia. Antipsychotic.
Safety
| Symbol(GHS) |   GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H300-H361 |
| Precautionary statements | P201-P202-P264-P270-P280-P301+P310 |
| RIDADR | 3249 |
| WGK Germany | WGK 3 |
| RTECS | HE0525000 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Repr. 2 |
