A7627458
Fluphenazinehydrochloride , 10mMinDMSO , 146-56-5
Synonym(s):
4-[3-[2-(Trifluoromethyl)-10H-phenothiazin-10-yl]propyl]-1-piperazineethanol dihydrochloride;Fluphenazine dihydrochloride
CAS NO.:146-56-5
Empirical Formula: C22H28Cl2F3N3OS
Molecular Weight: 510.44
MDL number: MFCD00055212
EINECS: 205-674-1
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200-2020C |
| storage temp. | 2-8°C |
| solubility | Soluble in DMSO and methanol. |
| form | Solid |
| color | White to Light yellow |
| Sensitive | Hygroscopic |
| Stability: | Hygroscopic |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C22H26F3N3OS.2ClH/c23-22(24,25)17-6-7-21-19(16-17)28(18-4-1-2-5-20(18)30-21)9-3-8-26-10-12-27(13-11-26)14-15-29;;/h1-2,4-7,16,29H,3,8-15H2;2*1H |
| InChIKey | MBHNWCYEGXQEIT-UHFFFAOYSA-N |
| SMILES | C12=CC(=CC=C1SC1C=CC=CC=1N2CCCN1CCN(CCO)CC1)C(F)(F)F.Cl.Cl |
| EPA Substance Registry System | Fluphenazine dihydrochloride (146-56-5) |
Description and Uses
antiandrogen, antineoplastic, Nuclear Hormone receptor antagonist
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301-H360 |
| Precautionary statements | P201-P280-P301+P330+P331+P310-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36/37/39-36 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| RTECS | TL9800000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2934302300 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Repr. 1A |
| Toxicity | guinea pig,LD50,intraperitoneal,299mg/kg (299mg/kg),Pharmazie. Vol. 38, Pg. 749, 1983. |








