BD0543853
2-Amino-4-(trifluoromethyl)benzenethiolhydrochloride , 95% , 4274-38-8
CAS NO.:4274-38-8
Empirical Formula: C7H7ClF3NS
Molecular Weight: 229.65
MDL number: MFCD00042600
EINECS: 429-560-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB80.00 | In Stock |
|
| 5g | RMB299.20 | In Stock |
|
| 25g | RMB1039.20 | In Stock |
|
| 100g | RMB3429.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 196-198 °C(lit.) |
| Density | 2.46 |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Sensitive | Hygroscopic |
| BRN | 4273774 |
| InChI | InChI=1S/C7H6F3NS.ClH/c8-7(9,10)4-1-2-6(12)5(11)3-4;/h1-3,12H,11H2;1H |
| InChIKey | FIAGYDIJZOWVAB-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)C1=CC=C(S)C(N)=C1.Cl |
| CAS DataBase Reference | 4274-38-8(CAS DataBase Reference) |
Description and Uses
2-Amino-4-(trifluoromethyl)benzenethiol hydrochloride may be used in the synthesis of 6-trifluoromethyl-4H-1,4-benzothiazines, via condensation and oxidative cyclization with β-di-carbonyl compounds.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,T |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2930909899 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






