Trifluoperazine Dihydrochloride , >98.0%(HPLC)(T) , 440-17-5
Synonym(s):
10-[3-(4-Methylpiperazin-1-yl)propyl]-2-(trifluoromethyl)-10H-phenothiazine dihydrochloride;Trifluoperazine dihydrochloride
CAS NO.:440-17-5
Empirical Formula: C21H26Cl2F3N3S
Molecular Weight: 480.42
MDL number: MFCD00012656
EINECS: 207-123-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB100.00 | In Stock |
|
| 5G | RMB379.20 | In Stock |
|
| 25G | RMB1215.20 | In Stock |
|
| 100g | RMB3199.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 243 °C (dec.)(lit.) |
| Flash point: | 9℃ |
| storage temp. | -20°C |
| solubility | ethanol: soluble5mg/mL |
| pka | pK1 3.9, pK2 8.1(at 25℃) |
| form | powder |
| color | white to off-white |
| Water Solubility | water: 50g/L, clear |
| λmax | 312nm(MeOH)(lit.) |
| Merck | 14,9680 |
| BRN | 3820024 |
| Stability: | Hygroscopic |
| InChI | 1S/C21H24F3N3S.2ClH/c1-25-11-13-26(14-12-25)9-4-10-27-17-5-2-3-6-19(17)28-20-8-7-16(15-18(20)27)21(22,23)24;;/h2-3,5-8,15H,4,9-14H2,1H3;2*1H |
| InChIKey | BXDAOUXDMHXPDI-UHFFFAOYSA-N |
| SMILES | Cl[H].Cl[H].CN1CCN(CCCN2c3ccccc3Sc4ccc(cc24)C(F)(F)F)CC1 |
| CAS DataBase Reference | 440-17-5(CAS DataBase Reference) |
| EPA Substance Registry System | 10H-Phenothiazine, 10-[3-(4-methyl-1-piperazinyl)propyl]-2-(trifluoromethyl)-, dihydrochloride (440-17-5) |
Description and Uses
Trifluoperazine (TFP) is a phenothiazine compound with anti-
Antipsychotic
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H319-H336-H341-H372-H410 |
| Precautionary statements | P201-P273-P301+P312+P330-P305+P351+P338-P308+P313 |
| target organs | Central nervous system, Eyes |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 3 |
| RTECS | SP1750000 |
| F | 3-10 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| HS Code | 29343000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Muta. 2 STOT RE 1 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







![2,3,4,5-Tetrahydro-1H-benzo[e][1,4]diazepinedihydrochloride](https://img.chemicalbook.com/CAS/GIF/5177-43-5.gif)

