M8395755
ProscillaridinA , 95% , 466-06-8
Synonym(s):
(3β)-3-[(6-Deoxy-α-L-mannopyranosyl)oxy]-14-hydroxybufa-4,20,22-trienolide;3-(6-Deoxy-α-L -mannopyranosyloxyl)-14-hydroxybufa-4,20,22-trienolide;Proscillaridin A;Scillarenin 3β-rhamnoside
CAS NO.:466-06-8
Empirical Formula: C30H42O8
Molecular Weight: 530.66
MDL number: MFCD00214065
EINECS: 207-370-4
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB1280.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 233°C |
| alpha | D20 -91.5° (CH3OH) |
| Boiling point: | 530.03°C (rough estimate) |
| Density | 1.33±0.1 g/cm3 (20 ºC 760 Torr) |
| refractive index | 1.4900 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO: 100 mg/mL (188.45 mM) |
| form | Solid |
| pka | 13.01±0.70(Predicted) |
| color | White to Off-White |
| Stability: | Hygroscopic |
| InChIKey | MYEJFUXQJGHEQK-RLQJMXQZSA-N |
| SMILES | C[C@]12CC[C@]3([H])[C@@]4(C)CC[C@H](O[C@]5([H])O[C@@H](C)[C@H](O)[C@@H](O)[C@H]5O)C=C4CC[C@@]3([H])[C@@]1(O)CC[C@@H]2C6=COC(C=C6)=O |
| LogP | 2.480 |
Description and Uses
antipsychotic
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310+P330 |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 28-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | UK6650000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Toxicity | LD50 in male, female rats (mg/kg): 56, 76 orally (Goldenthal) |






