PRODUCT Properties
| Melting point: | 232 °C |
| Boiling point: | 177 °C(Press: 20 Torr) |
| Density | 0.9946 g/cm3(Temp: 25 °C) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Oil |
| color | Colourless to Pale Yellow |
| InChI | InChI=1S/C15H22O/c1-10(2)12-5-7-15(4)8-6-14(16)11(3)13(15)9-12/h12H,1,5-9H2,2-4H3/t12-,15+/m1/s1 |
| InChIKey | KUFXJZXMWHNCEH-DOMZBBRYSA-N |
| SMILES | C1(C)=C2[C@@](C)(CC[C@@H](C(C)=C)C2)CCC1=O |
| LogP | 4.220 (est) |
Description and Uses
(+)-α-Cyperone is used as an anti-inflammatory agent, isolated from the rhizomes of Cyperus rotundus.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Safety Statements | 24/25 |
| HS Code | 29143990 |
