M9047034
5-Amino-2-methyl-2H-tetrazole , 98% , 6154-04-7
CAS NO.：6154-04-7
Empirical Formula: C2H5N5
Molecular Weight: 99.09
MDL number: MFCD01819831
EINECS: 612-169-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB33.60 | In Stock |
|
| 5g | RMB61.60 | In Stock |
|
| 25g | RMB278.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 104.5-105.5 °C |
| Boiling point: | 282.9±23.0 °C(Predicted) |
| Density | 1.75±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 2.43±0.10(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C2H5N5/c1-7-5-2(3)4-6-7/h1H3,(H2,3,5) |
| InChIKey | AZUKLCJYWVMPML-UHFFFAOYSA-N |
| SMILES | N1=C(N)N=NN1C |
| CAS DataBase Reference | 6154-04-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Amino-2-methyl-2H-tetrazole(6154-04-7) |
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H228-H302-H315-H319-H335 |
| Precautionary statements | P210-P233-P240-P241-P260-P261-P264-P270-P271-P280-P301+P312-P302+P352-P304-P304+P340-P305+P351+P338-P312-P321-P330-P332+P313-P337+P313-P340-P362-P370+P378-P403-P403+P233-P405-P501 |
| RIDADR | UN1325 |
| HazardClass | 4.1 |
| HS Code | 2933998090 |
| Limited Quantities | 1.0 Kg (2.2 lbs) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
