M9347934
Altenuene , 98% , 29752-43-0
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB3440.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | 2-8°C |
| form | Solid |
| color | White to off-white |
| Major Application | food and beverages |
| InChI | InChI=1/C15H16O6/c1-15-6-12(18)10(16)5-9(15)8-3-7(20-2)4-11(17)13(8)14(19)21-15/h3-5,10,12,16-18H,6H2,1-2H3/t10-,12-,15-/s3 |
| InChIKey | MMHTXEATDNFMMY-BSZOFMBKNA-N |
| SMILES | [C@@]12(C)C[C@@H](O)[C@H](O)C=C1C1=CC(OC)=CC(O)=C1C(=O)O2 |&1:0,3,5,r| |
Description and Uses
Altenuene is a heptaketide isolated from an endolichenic fungal strain Nigrospora sphaerica[1].
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS06 |
| Signal word | Danger |
| Hazard statements | H310-H330-H360-H300 |
| Precautionary statements | P264-P270-P301+P310-P321-P330-P405-P501-P260-P271-P284-P304+P340-P310-P320-P403+P233-P405-P501-P262-P264-P270-P280-P302+P350-P310-P322-P361-P363-P405-P501 |
| Hazard Codes | T+ |
| Risk Statements | 61-26/27/28 |
| Safety Statements | 53-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | HP8758000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |






