M9916652
PolyMethoxypolyethyleneglycolpropionicacid , ≥95% , 125220-94-2
Synonym(s):
O-(2-Carboxyethyl)-O′-methylpolyethylene glycol 5,000;mono-Methyl polyethylene glycol 5′000 propionic acid
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB1200.00 | In Stock |
|
| 1g | RMB3600.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | −20°C |
| form | lumps |
| α-end | methoxy |
| Ω-end | carboxylic acid |
| InChI | InChI=1S/C6H12O4/c1-9-4-5-10-3-2-6(7)8/h2-5H2,1H3,(H,7,8) |
| InChIKey | KWMXBFIAGYXCCC-UHFFFAOYSA-N |
| SMILES | C(CC(=O)O)O{-}CC{+n}OC |
Description and Uses
m-PEG24-acid is a PEG linker containing a terminal carboxylic acid. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The hydrophilic PEG spacer increases solubility in aqueous media.
m-PEG-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352-P304+P340-P305+P351+P338-P312-P321 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| F | 10-23 |
| HS Code | 2942000090 |
| Storage Class | 11 - Combustible Solids |




