BD3087857
2,5,8,11,14,17,20,23,26,29,32,35,38-Tridecaoxahentetracontan-41-oicacid , 95% , 2170098-33-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB300.80 | In Stock |
|
| 1g | RMB811.20 | In Stock |
|
| 5g | RMB3908.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | Store at Room Tem. |
| solubility | Soluble in DMSO, DCM, DMF |
| form | Solid |
| InChIKey | RQQVDBLIIIQXET-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOC |
Description and Uses
m-PEG13-acid is a PEG linker containing a terminal carboxylic acid. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The hydrophilic PEG spacer increases solubility in aqueous media.
m-PEG13-acid is a PEG linker containing a terminal carboxylic acid. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The hydrophilic PEG spacer increases solubility in aqueous media.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
