M7249958
m-PEG12-COOH , 2135793-73-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB3184.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 628.8±55.0 °C(Predicted) |
| Density | 1.113±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| solubility | Soluble in Water, DMSO, DCM, DMF |
| form | liquid |
| pka | 4.28±0.10(Predicted) |
| color | Colourless |
| InChI | InChI=1S/C26H52O14/c1-29-4-5-31-8-9-33-12-13-35-16-17-37-20-21-39-24-25-40-23-22-38-19-18-36-15-14-34-11-10-32-7-6-30-3-2-26(27)28/h2-25H2,1H3,(H,27,28) |
| InChIKey | JMAKFNFKUHXFBH-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOC |
Description and Uses
m-PEG12-acid is a PEG linker containing a terminal carboxylic acid. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The hydrophilic PEG spacer increases solubility in aqueous media.
MeO-?PEG(12)?-?COOH is used in the preparation of fishbone-?like polymer brushes with potential applications in the production of smart materials and biosensors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352-P362+P364 |
| HS Code | 2918999090 |
