PRODUCT Properties
| Melting point: | 14°C |
| Boiling point: | 117°C 10mm |
| Density | 0,955 g/cm3 |
| refractive index | 1.4308 |
| Flash point: | >65°C |
| Specific Gravity | 1.04-1.06 |
| Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems |
| InChI | InChI=1S/C12H30O3Si3/c1-7-16(8-2)13-17(9-3,10-4)15-18(11-5,12-6)14-16/h7-12H2,1-6H3 |
| InChIKey | KMPBCFZCRNKXSA-UHFFFAOYSA-N |
| SMILES | O1[Si](CC)(CC)O[Si](CC)(CC)O[Si]1(CC)CC |
| CAS DataBase Reference | 2031-79-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,1,3,3,5,5-Hexaethylcyclotrisiloxane(2031-79-0) |
| EPA Substance Registry System | Cyclotrisiloxane, hexaethyl- (2031-79-0) |
Description and Uses
Hexaethylcyclotrisiloxane can be used to prepare nano-protective coating.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| TSCA | Yes |
