MR0977058
97% , 2816-43-5
Synonym(s):
Triphenylgermane;Triphenylgermanyl hydride
CAS NO.:2816-43-5
Empirical Formula: C18H16Ge
Molecular Weight: 304.96
MDL number: MFCD00046034
EINECS: 220-569-0
| Pack Size | Price | Stock | Quantity |
| 2.5g | RMB2557.60 | In Stock |
|
| 10g | RMB8276.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 40-43 °C (lit.) |
| Boiling point: | 128-9°C 0,03mm |
| refractive index | 1.6187 |
| Flash point: | >110°C |
| form | powder or crystals solid |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | InChI=1S/C18H16Ge/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,19H |
| InChIKey | NXHORDQDUDIXOS-UHFFFAOYSA-N |
| SMILES | [GeH](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
Description and Uses
It may be used in the isomerization of (Z) alkene.1 TEMPO (2,2,6,6-Tetramethylpiperidinyloxy) reacts with triphenylgermanium hydride to form its corresponding germyl radical. 2
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| TSCA | No |







