MR6712756
98% , 136054-22-3
Synonym(s):
[D -Lys3]-Growth Hormone Releasing Peptide 6;[His1, D -Lys3, Lys6]-GHRP;His-D -Trp-D -Lys-Trp-D -Phe-Lys-NH2
CAS NO.:136054-22-3
Empirical Formula: C49H63N13O6
Molecular Weight: 930.11
MDL number: MFCD00214665
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB5164.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 1422.5±65.0 °C(Predicted) |
| Density | 1.314±0.06 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | Soluble to 0.50 mg/ml in H2O |
| pka | 13.37±0.46(Predicted) |
| form | lyophilized powder |
| biological source | synthetic |
| Water Solubility | Soluble in water. |
| Stability: | Hygroscopic |
| InChIKey | MGSNWNLPMHXGDD-DFWOJPNQSA-N |
| SMILES | C(C1=CNC2=CC=CC=C12)[C@H](NC(=O)[C@@H](CCCCN)NC(=O)[C@H](NC(=O)[C@@H](N)CC1NC=NC=1)CC1=CNC2=CC=CC=C12)C(=O)N[C@@H](C(=O)N[C@H](C(=O)N)CCCCN)CC1C=CC=CC=1 |
Description and Uses
[D-Lys3]-GHRP6 has been used-
- to treat bovine somatotropes to determine the release of GH from treated cells and non-treated or control cells
- for intraperitoneal injection to groups of broiler chicken to determine the effect on feed intake, weight gain, and feed conversion ratio
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P305+P351+P338 |
| WGK Germany | 3 |





