MR7070556
39145-47-6
CAS NO.:39145-47-6
Empirical Formula: C12H8ClNO3
Molecular Weight: 249.65
MDL number: MFCD00024208
EINECS: 254-316-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB204.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | Storage temp. 2-8°C |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C12H8ClNO3/c13-9-5-7-10(8-6-9)17-12-4-2-1-3-11(12)14(15)16/h1-8H |
| InChIKey | KVYVAGCVKWBOBS-UHFFFAOYSA-N |
| SMILES | C1(OC2=CC=C(Cl)C=C2)=CC=CC=C1[N+]([O-])=O |
Description and Uses
1-(4-Chlorophenoxy)-2-nitrobenzene is used as a reagent in the synthesis of novel benzamide derivatives containing a diphenyl ether moiety which display good antifungal and insecticidal properties. 1-(4-chlorophenoxy)-2-nitrobenzene also displays fungicidal activity against certain phytopathogenic fungi.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS05 |
| Signal word | Danger |
| Hazard statements | H315-H335-H302-H318-H317 |
| Precautionary statements | P261-P272-P280-P302+P352-P333+P313-P321-P363-P501-P280-P305+P351+P338-P310-P264-P280-P302+P352-P321-P332+P313-P362-P264-P270-P301+P312-P330-P501 |
| RIDADR | UN3077 |
| HazardClass | 9 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






