MR7232856
98% , 330-95-0
Synonym(s):
N,N′-bis(4-Nitrophenyl)urea compound with 4,6-dimethyl-2-pyrimidinone
CAS NO.:330-95-0
Empirical Formula: C19H18N6O6
Molecular Weight: 426.38
MDL number: MFCD00867204
EINECS: 206-359-1
| Pack Size | Price | Stock | Quantity |
| 100g | RMB4640.00 | In Stock |
|
| 500g | RMB18560.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 265-267 °C |
| Boiling point: | 541.86°C (rough estimate) |
| Density | 1.4663 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | 0-6°C |
| solubility | DMSO: soluble0.5mg/mL |
| form | Solid |
| color | Yellow to Dark Yellow |
| InChI | InChI=1S/C13H10N4O5.C6H8N2O/c18-13(14-9-1-5-11(6-2-9)16(19)20)15-10-3-7-12(8-4-10)17(21)22;1-4-3-5(2)8-6(9)7-4/h1-8H,(H2,14,15,18);3H,1-2H3,(H,7,8,9) |
| InChIKey | UKHWDRMMMYWSFL-UHFFFAOYSA-N |
| SMILES | C1(=CC=C([N+]([O-])=O)C=C1)NC(NC1=CC=C([N+]([O-])=O)C=C1)=O.C1(C)=NC(=NC(C)=C1)O |
| EPA Substance Registry System | Nicarbazin (330-95-0) |
Description and Uses
Nicarbazin, is a coccidiostat, which is an antiprotozoal agent that acts upon Coccidia parasites.It is a contraceptive for resident Canada geese and waterfowl. It is used to study avian reproduction and is used to interfere with the formation of the vitelline (yolk) membrane in bird eggs. It has been used to study how delivery method can effect plasma levels of 4,4′-dinitrocarbanilide (DNC), which is the active anticoccidial component of Nicarbazin.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | FE0900000 |
| HS Code | 38249099 |
| Hazardous Substances Data | 330-95-0(Hazardous Substances Data) |




