S026779
Ethyl acetate-d8 , 99.5atom%D,99%(CP) , 117121-81-0
Synonym(s):
Ethyl-d5 acetate-d3
| Pack Size | Price | Stock | Quantity |
| 500mg | RMB1189.05 | In Stock |
|
| 1g | RMB1491.48 | In Stock |
|
| 5g | RMB6329.82 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -84 °C(lit.) |
| Boiling point: | 77 °C(lit.) |
| Density | 0.984 g/mL at 25 °C |
| refractive index | n |
| Flash point: | -3 °C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Colourless |
| Stability: | Volatile |
| InChI | InChI=1S/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3/i1D3,2D3,3D2 |
| InChIKey | XEKOWRVHYACXOJ-AUOAYUKBSA-N |
| SMILES | O(C([2H])([2H])C([2H])([2H])[2H])C(=O)C([2H])([2H])[2H] |
| CAS Number Unlabeled | 141-78-6 |
Description and Uses
Ethyl acetate-d8 was used as one of the analytical standards during the quantification of volatile components present in extra virgin olive oil (EVOO) samples.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H319-H336 |
| Precautionary statements | P210-P233-P240-P241-P242-P305+P351+P338 |
| target organs | Central nervous system |
| Hazard Codes | F,Xi |
| Risk Statements | 36/37/38-67-66-36-11 |
| Safety Statements | 16-26-36/37/39-33 |
| RIDADR | UN 1173 3/PG 2 |
| WGK Germany | 3 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 STOT SE 3 |







