PRODUCT Properties
| Melting point: | ~350 °C (dec.) (lit.) |
| Boiling point: | 491.8±45.0 °C(Predicted) |
| Density | 2.687±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | DMSO (Heated), Methanol (Slightly) |
| pka | 0.01±0.10(Predicted) |
| form | Solid |
| color | White |
| InChI | 1S/C8H2Br4O4/c9-3-1(7(13)14)4(10)6(12)2(5(3)11)8(15)16/h(H,13,14)(H,15,16) |
| InChIKey | PNXPXUDJXYVOFM-UHFFFAOYSA-N |
| SMILES | OC(=O)c1c(Br)c(Br)c(C(O)=O)c(Br)c1Br |
| CAS DataBase Reference | 5411-70-1(CAS DataBase Reference) |
Description and Uses
Tetrabromoterephthalic Acid is an active reagent for the preparation of copper tetrabromoterephthalate imidazolle/pyridine complexes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
