A3447412
2,6-Dibromobenzaldehyde , >98.0%(GC) , 67713-23-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB25.60 | In Stock |
|
| 1G | RMB34.40 | In Stock |
|
| 5g | RMB107.20 | In Stock |
|
| 25g | RMB455.20 | In Stock |
|
| 100g | RMB1679.20 | In Stock |
|
| 500g | RMB7519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-93℃ |
| Boiling point: | 279℃ |
| Density | 1.977 |
| Flash point: | 109℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| color | White to Yellow to Green |
| InChI | InChI=1S/C7H4Br2O/c8-6-2-1-3-7(9)5(6)4-10/h1-4H |
| InChIKey | YDYNSAUGVGAOLO-UHFFFAOYSA-N |
| SMILES | C(=O)C1=C(Br)C=CC=C1Br |
Description and Uses
2,6-Dibromobenzaldehyde is an important organic synthesis intermediate and can be used to synthesize a variety of other organic compounds, such as 2,6-dibromobenzoic acid, 2,6-dibromophenethanol, etc.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| HazardClass | IRRITANT |
| HS Code | 2913000090 |
