PRODUCT Properties
| Melting point: | 192°C |
| Boiling point: | 366.1±42.0 °C(Predicted) |
| Density | 2.1779 (rough estimate) |
| refractive index | 1.5438 (estimate) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | pK1:1.41 (25°C) |
| color | White to Orange to Green |
| Water Solubility | 3.5g/L(15 ºC) |
| InChI | InChI=1S/C7H3Br3O2/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2H,(H,11,12) |
| InChIKey | GHVMJSHEGZYRQL-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=C(Br)C=C(Br)C=C1Br |
| CAS DataBase Reference | 633-12-5(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 2916.39.7900 |






