PRODUCT Properties
| storage temp. | room temp |
| solubility | methanol: water (1:1): 10mg/mL, clear to hazy, red-orange |
| Colour Index | 48035 |
| form | powder |
| λmax | 490 nm |
| ε(extinction coefficient) | ≥19000 at 487-493nm ≥3000 at 268-274nm |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C22H22N2.ClH/c1-15-16(17-9-5-7-11-19(17)23-15)13-14-21-22(2,3)18-10-6-8-12-20(18)24(21)4;/h5-14H,1-4H3;1H |
| InChIKey | ZOMLUNRKXJYKPD-UHFFFAOYSA-N |
| SMILES | [Cl-].Cc1[nH]c2ccccc2c1\C=C\C3=[N+](C)c4ccccc4C3(C)C |
| EPA Substance Registry System | 1H-Indole, 2,3-dihydro-1,3,3-trimethyl-2-[2-(2-methyl-3H-indol-3-ylidene)ethylidene]-, hydrochloride (1:1) (3056-93-7) |
Description and Uses
Metachromatic dye
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P264-P280-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-28-36/37/39-45 |
| WGK Germany | 3 |
| RTECS | NM2251000 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
