S0395516
4,4′-Dinitro-2-biphenylamine , 98% , 51787-75-8
CAS NO.:51787-75-8
Empirical Formula: C12H9N3O4
Molecular Weight: 259.22
MDL number: MFCD00075056
EINECS: 257-417-8
| Pack Size | Price | Stock | Quantity |
| 25g | RMB1239.58 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 208-210 °C(lit.) |
| Boiling point: | 472.0±30.0 °C(Predicted) |
| Density | 1.434±0.06 g/cm3(Predicted) |
| storage temp. | room temp |
| solubility | Ethanol, Methanol |
| form | Crystals |
| pka | 0.54±0.10(Predicted) |
| color | Red |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C12H9N3O4/c13-12-7-10(15(18)19)5-6-11(12)8-1-3-9(4-2-8)14(16)17/h1-7H,13H2 |
| InChIKey | FRZPYFUNNLIMEC-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C([N+]([O-])=O)C=C2)=CC=C([N+]([O-])=O)C=C1N |
| CAS DataBase Reference | 51787-75-8 |
Description and Uses
4,4’-Dinitro-2-biphenylamine (cas# 51787-75-8) is a compound useful in organic synthesis.Dyes and metabolites.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





