S0396416
BioReagent,suitableforfluorescence,≥95.0%(CHN) , 68654-25-1
CAS NO.:68654-25-1
Empirical Formula: C10H10Br2N2O2
Molecular Weight: 350.01
MDL number: MFCD00036952
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB1117.91 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 170-172 °C(lit.) |
| Boiling point: | 371.8±52.0 °C(Predicted) |
| Density | 1.98±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMF: soluble |
| pka | -4.55±0.70(Predicted) |
| form | Solid |
| color | Yellow |
| Appearance | Solid Powder |
| BRN | 4189453 |
| Stability: | Light Sensitive |
| InChI | 1S/C10H10Br2N2O2/c1-5-7(3-11)13-8(4-12)6(2)10(16)14(13)9(5)15/h3-4H2,1-2H3 |
| InChIKey | OSIYFMVMZXJKSP-UHFFFAOYSA-N |
| SMILES | CC1=C(CBr)N2N(C1=O)C(=O)C(C)=C2CBr |
Description and Uses
Dibromobimane is a non-ionic, fluorescent probe for labeling thiols and crosslinking proteins.
Dibromobimane, a bifunctional thiol reagent, is used as a cross-linking agent for cysteine mapping and studies on protein structure/conformation and cross-linking processes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 8-10-21 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






