S0398916
97% , 41687-30-3
CAS NO.:41687-30-3
Empirical Formula: C8H9NO5S
Molecular Weight: 231.23
MDL number: MFCD00134178
EINECS: 255-501-9
| Pack Size | Price | Stock | Quantity |
| 5g | RMB1593.39 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 76-78 °C (lit.) |
| Boiling point: | 104.7℃ at 95.992kPa |
| Density | 0.588g/cm3 at 32℃ |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | room temp |
| form | Solid |
| pka | 13.56±0.10(Predicted) |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C8H9NO5S/c10-4-5-15(13,14)8-3-1-2-7(6-8)9(11)12/h1-3,6,10H,4-5H2 |
| InChIKey | VMORQDKKMBAQPJ-UHFFFAOYSA-N |
| SMILES | OCCS(=O)(=O)c1cccc(c1)[N+]([O-])=O |
| LogP | 0.32 at 32℃ and pH4.37 |
| Dissociation constant | 0-0 at 28℃ |
| EPA Substance Registry System | Ethanol, 2-[(3-nitrophenyl)sulfonyl]- (41687-30-3) |
Description and Uses
diagnostic assay manufacturing
hematology
histology
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |


