S0406216
Methyl-d3 trifluoromethane sulfonate , 99atom%D , 73900-07-9
Synonym(s):
Methyl-d3 triflate
| Pack Size | Price | Stock | Quantity |
| 5g | RMB1183.34 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 94-99 °C(lit.) |
| Density | 1.477 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 101 °F |
| storage temp. | 2-8°C |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C2H3F3O3S/c1-8-9(6,7)2(3,4)5/h1H3/i1D3 |
| InChIKey | OIRDBPQYVWXNSJ-FIBGUPNXSA-N |
| SMILES | S(=O)(=O)(C(F)(F)F)OC([2H])([2H])[2H] |
Description and Uses
Deuterated analog of the powerful methylating agent, methyl triflate.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS02,GHS05,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H226-H301+H311-H314-H351 |
| Precautionary statements | P202-P210-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | 10-23/24/25-34-40 |
| Safety Statements | 16-26-36/37/39-45 |
| RIDADR | UN 2920 8/PG 2 |
| WGK Germany | 3 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 3 Dermal Acute Tox. 3 Oral Eye Dam. 1 Flam. Liq. 3 Skin Corr. 1B |







