S0412116
Acenaphthene-d10 , 99atom%D , 15067-26-2
Synonym(s):
1,8-·Ethylenenaphthalene-D10;Deuterated acenaphthene
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB563.19 | In Stock |
|
| 1g | RMB1694.09 | In Stock |
|
| 5g | RMB5645.48 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95-97 °C(lit.) |
| Boiling point: | 277-279 °C(lit.) |
| storage temp. | room temp |
| solubility | Chloroform (Sparingly), Methanol (Slightly, Sonicated) |
| form | Solid |
| color | White to off-white |
| Major Application | environmental |
| InChI | InChI=1S/C12H10/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-6H,7-8H2/i1D,2D,3D,4D,5D,6D,7D2,8D2 |
| InChIKey | CWRYPZZKDGJXCA-WHUVPORUSA-N |
| SMILES | C12C3C(=C([2H])C([2H])=C1C([2H])([2H])C([2H])([2H])C=2C([2H])=C([2H])C=3[2H])[2H] |
| EPA Substance Registry System | Acenaphthene-d10 (15067-26-2) |
| CAS Number Unlabeled | 83-32-9 |
Description and Uses
May be used as an analytical standard
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
| target organs | Eyes,Central nervous system |
| Hazard Codes | Xi,T,N,Xn |
| Risk Statements | 36/37/38-63-43-23/24/25-45-39/23/24/25-50/53-52/53-67-40 |
| Safety Statements | 26-37/39-36/37-24/25-23-53-45-61-60 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |





