S0419516
Ethyl acetoacetate-1,2,3,4-13C4 , 99atom%13C,99%(CP) , 84508-55-4
| Pack Size | Price | Stock | Quantity |
| 500mg | RMB6247.54 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −43 °C(lit.) |
| Boiling point: | 181 °C(lit.) |
| Density | 1.052 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 184 °F |
| storage temp. | Refrigerator |
| solubility | Chloroform (Soluble), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Oil |
| color | Colourless |
| InChI | 1S/C6H10O3/c1-3-9-6(8)4-5(2)7/h3-4H2,1-2H3/i2+1,4+1,5+1,6+1 |
| InChIKey | XYIBRDXRRQCHLP-XMUWKQMQSA-N |
| SMILES | CCO[13C](=O)[13CH2][13C]([13CH3])=O |
| CAS Number Unlabeled | 141-97-9 |
Description and Uses
Ethyl Acetoacetate-13C4 is the isotope labelled analog of Ethyl Acetoacetate (E899545(P)), a chemical intermediate used in the production of various analgesics, antibiotics and antimalarial agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-41 |
| Safety Statements | 26-36 |
| RIDADR | UN 1993 / PGIII |
| WGK Germany | 3 |
| Storage Class | 10 - Combustible liquids |






