PRODUCT Properties
| Melting point: | <25 °C |
| Boiling point: | 186-190 °C/12 mmHg (lit.) |
| Density | 1.04 g/mL at 20 °C (lit.) |
| refractive index | n |
| Flash point: | 100℃ |
| pka | 8.10±0.30(Predicted) |
| form | liquid |
| Specific Gravity | 1.05 |
| Odor | Odorless or slight fruity odor |
| BRN | 3097754 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Combustible. |
| Cosmetics Ingredients Functions | UV ABSORBER FRAGRANCE |
| InChI | 1S/C17H24O3/c1-11(2)13-9-8-12(3)10-16(13)20-17(19)14-6-4-5-7-15(14)18/h4-7,11-13,16,18H,8-10H2,1-3H3 |
| InChIKey | SJOXEWUZWQYCGL-UHFFFAOYSA-N |
| SMILES | CC(C)C1CCC(C)CC1OC(=O)c2ccccc2O |
| LogP | 6.429 (est) |
| EPA Substance Registry System | Benzoic acid, 2-hydroxy-, (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester, rel- (89-46-3) |
Description and Uses
Menthyl salicylate is almost odorless when pure. Slightly bitter-astringent taste. It carries the usual characteristics of a phenol, which are not exactly welcome by the perfumer.
light stabilizer
Safety
| Hazard statements | H413 |
| PPE | Eyeshields, Gloves |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 4 |
