PRODUCT Properties
| Melting point: | 170-172 °C (dec.)(lit.) |
| Boiling point: | 720.5±55.0 °C(Predicted) |
| Density | 1.280±0.06 g/cm3(Predicted) |
| solubility | water: soluble25mg/mL, clear, colorless |
| pka | 12.69±0.23(Predicted) |
| form | solid |
| Water Solubility | water: soluble 25mg/mL, clear, colorless |
| InChI | 1S/C4H7N3O3/c8-1-5-4(6-2-9)7-3-10/h1-4H,(H,5,8)(H,6,9)(H,7,10) |
| InChIKey | HNPCDFJZADHNHD-UHFFFAOYSA-N |
| SMILES | [H]C(=O)NC(NC([H])=O)NC([H])=O |
Description and Uses
N,N′N′′-methylidynetrisformamide (TRIFO) is a source for formamide; used for N-formylformamidine (H2N-CH=N-CHO); for the N-formylformimidoyl group (H-C=NHCHO) as a building block in heterocyclic synthesis).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
