S060779
≥95.0%(HPLC) , 18466-51-8
Synonym(s):
3-(Glucosyloxy)-4′,5,7-trihydroxyflavylium chloride;Callistephin chloride;Pelargonidin 3-O-glucoside chloride
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB1145.22 | In Stock |
|
| 5mg | RMB4490.11 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | -20°C |
| solubility | Chloroform: soluble,Dichloromethane: soluble,DMSO: soluble,Ethyl Acetate: soluble |
| form | powder |
| color | Dark, reddish |
| biological source | synthetic |
| Stability: | Hygroscopic |
| InChIKey | CAHGSEFWVUVGGL-MLBDBNLCNA-N |
| SMILES | O([C@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)O)C1=CC2=C(C=C(O)C=C2[O+]=C1C1C=CC(O)=CC=1)O.[Cl-] |&1:1,2,3,5,7,r| |
| CAS DataBase Reference | 18466-51-8(CAS DataBase Reference) |
Description and Uses
Pelargonidin 3-O-β-glucopyranoside is a naturally occurring anthocyanin found in strawberries and other fruits and flowers. Pelargonidin 3-O-β-glucopyranoside is known to exert potential antiinflammatory, anti-adhesive, anti-estrogenic, and angiotensin-converting enzyme inhibitory activities. Pelargonidin 3-Glucoside is also the glucoside of Pelargonidin (P218500), an potential antidiabetic agent.
Safety
| WGK Germany | 3 |
| F | 10-21 |





