S073879
5-(4-Chlorophenyl)-1,3-cyclohexanedione , 95% , 27463-38-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB1460.04 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 185-189 °C(lit.) |
| Boiling point: | 384.217±42.00 °C(Press: 760.00 Torr)(predicted) |
| Density | 1.268±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) |
| pka | 4.840±0.20(predicted) |
| InChI | 1S/C12H11ClO2/c13-10-3-1-8(2-4-10)9-5-11(14)7-12(15)6-9/h1-4,9H,5-7H2 |
| InChIKey | MAFYKXZPGMHTIA-UHFFFAOYSA-N |
| SMILES | Clc1ccc(cc1)C2CC(=O)CC(=O)C2 |
Description and Uses
5-(4-Chlorophenyl)-1,3-cyclohexanedione may be used in the synthesis of 3-(5-(4-chlorophenyl)-3-oxocyclohex-1-enylamino)thiophene-2-carbonitrile.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H302+H312+H332-H315 |
| Precautionary statements | P301+P312-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2914790090 |
| Storage Class | 13 - Non Combustible Solids |






