S0803249
Sorbicacid , phyproof?ReferenceSubstance , 110-44-1
Synonym(s):
(3S,7R)-3,4,5,6,7,8,9,10,11,12-Decahydro-7,14,16-trihydroxy-3-methyl-1H-2-benzoxacyclotetradecin-1-one solution;2,4-Dihydroxy-6-(6α,10-dihydroxyundecyl)benzoic acid μ-lactone;2,4-Dihydroxy-6-(6α,10-dihydroxyundecyl)benzoic acid μ-lactone solution
CAS NO.:110-44-1
Empirical Formula: C18H26O5
Molecular Weight: 322.4
MDL number: MFCD00864182
EINECS: 247-769-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB2055.34 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 182-184°C |
| alpha | D +46.3° (c = 1.0 in methanol) |
| Boiling point: | 381.01°C (rough estimate) |
| Density | 1.0919 (rough estimate) |
| refractive index | 1.6120 (estimate) |
| Flash point: | 2℃ |
| storage temp. | -20°C |
| solubility | DMF: Soluble; DMSO: Soluble; Ethanol: Soluble; Methanol: Soluble |
| form | A solid |
| pka | 8.08±0.60(Predicted) |
| color | Off-white to light yellow |
| biological source | synthetic (organic) |
| Stability: | Hygroscopic |
| InChI | 1S/C18H26O5/c1-12-6-5-9-14(19)8-4-2-3-7-13-10-15(20)11-16(21)17(13)18(22)23-12/h10-12,14,19-21H,2-9H2,1H3/t12-,14+/m0/s1 |
| InChIKey | DWTTZBARDOXEAM-GXTWGEPZSA-N |
| SMILES | C[C@H]1CCC[C@H](O)CCCCCc2cc(O)cc(O)c2C(=O)O1 |
| CAS DataBase Reference | 26538-44-3 |
| EPA Substance Registry System | Zeranol (26538-44-3) |
Description and Uses
Animal growth promotant. Anabolic. Controlled substance
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS08 |
| Signal word | Danger |
| Hazard statements | H314-H361d |
| Precautionary statements | P201-P260-P280-P301+P330+P331-P303+P361+P353-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T,Xn,F |
| Risk Statements | 60-36/37/38-36-20/21/22-11 |
| Safety Statements | 53-36/37/39-45-36/37-16 |
| RIDADR | UN 1648 3 / PGII |
| WGK Germany | 3 |
| RTECS | DM2520000 |
| TSCA | TSCA listed |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Repr. 2 Skin Corr. 1B |
| Toxicity | LD50 in mice (mg/kg): 4400 i.p.; >40000 orally (Baldwin) |



