S0806849
forsynthesis , 13361-32-5
Synonym(s):
2-(3,4-Dihydroxyphenyl)ethyl-1,1,2,2-d4-amine hydrochloride;Dopamine-d4 hydrochloride
| Pack Size | Price | Stock | Quantity |
| 50mL | RMB1498.46 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 2410C(dec) |
| Flash point: | 11℃ |
| storage temp. | -20°C |
| solubility | DMF: 30 mg/ml,DMSO: 30 mg/ml,Ethanol: 1 mg/ml,PBS (pH 7.2): 5 mg/ml |
| form | Solid |
| color | White to off-white |
| Major Application | forensics and toxicology pharmaceutical veterinary |
| InChI | InChI=1S/C8H11NO2.ClH/c9-4-3-6-1-2-7(10)8(11)5-6;/h1-2,5,10-11H,3-4,9H2;1H/i3D2,4D2; |
| InChIKey | CTENFNNZBMHDDG-URZLSVTISA-N |
| SMILES | C1(C([2H])([2H])C([2H])([2H])N)=CC=C(O)C(O)=C1.Cl |
| CAS Number Unlabeled | 62-31-7 |
Description and Uses
Labelled Dopamine. Endogenous catecholamine with α and β-adrenergic activity. Cardiotonic; antihypotensive.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P233-P280-P301+P310-P303+P361+P353-P304+P340+P311 |
| Hazard Codes | Xi,T,F |
| Risk Statements | 37/38-41-39/23/24/25-23/24/25-11 |
| Safety Statements | 26-36/37/39-45-36/37-16 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |




