PRODUCT Properties
| Melting point: | 103-106°C |
| Flash point: | 9℃ |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Pale Yellow |
| Stability: | Hygroscopic |
| Major Application | forensics and toxicology |
| InChI | 1S/C10H12N2O2/c1-12-8(5-9(13)10(12)14)7-3-2-4-11-6-7/h2-4,6,8-9,13H,5H2,1H3/t8-,9+/m0/s1/i1D3 |
| InChIKey | XOKCJXZZNAUIQN-IRPRQUBLSA-N |
| SMILES | N1([C@@H](C[C@H](C1=O)O)c2cnccc2)C([2H])([2H])[2H] |
| CAS DataBase Reference | 159956-78-2 |
Description and Uses
A labelled metabolite of Nicotine. Carcinogen.-20C Freezer
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P260-P280-P301+P310-P311 |
| target organs | Eyes |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 7-16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol |
| WGK Germany | 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |






