S0928016
Furaltadone (+)-tartrate salt , 14343-71-6
Synonym(s):
5-Morpholinomethyl-3-(5-nitrofurfurylideneamino)-2-oxazolidinone
CAS NO.:14343-71-6
Empirical Formula: C17H22N4O12
Molecular Weight: 474.38
MDL number: MFCD00058306
EINECS: 238-293-4
| Pack Size | Price | Stock | Quantity |
| 25g | RMB525.57 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 173 °C |
| storage temp. | 2-8°C |
| InChIKey | NUQMJOZPYRELIB-FJUODKGNSA-N |
| SMILES | OC(C(O)C(O)=O)C(O)=O.[O-][N+](=O)c1ccc(\C=N\N2CC(CN3CCOCC3)OC2=O)o1 |
Description and Uses
Furaltadone L-tartrate (Altafur L-tartrate), a nitrofuran agent, has the potential for the study in infections of chickens with salmonella enteritidis. Furaltadone is inhibitory and bactericidal in vitro for staphylococci [1][2].
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H351 |
| Precautionary statements | P201-P301+P312+P330-P308+P313 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn |
| Risk Statements | 22-40 |
| Safety Statements | 22-36 |
| RIDADR | 3249 |
| WGK Germany | 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 |







