PRODUCT Properties
| Melting point: | 250 °C (dec.) (lit.) |
| Boiling point: | 439.64°C (rough estimate) |
| Density | 1.4281 (rough estimate) |
| refractive index | 1.5910 (estimate) |
| solubility | Acetonitrile (Very Slightly), DMSO (Slightly), Methanol (Very Slightly) |
| form | Solid |
| color | Pale Yellow to Yellow |
| InChI | 1S/C14H6N2O6/c17-13-7-3-1-5-9(15(19)20)11(7)14(18)8-4-2-6-10(12(8)13)16(21)22/h1-6H |
| InChIKey | XVMVHWDCRFNPQR-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cccc2C(=O)c3c(cccc3[N+]([O-])=O)C(=O)c12 |
| EPA Substance Registry System | 9,10-Anthracenedione, 1,5-dinitro- (82-35-9) |
Description and Uses
1,5-Dinitroanthraquinone has been used in a study to understand the effect of its oxygenous substituents on the color ratio, when it is a part of spectral flare compositions. It may be used to prepare 3,4,7,8-tetrabromo-1,5-dinitroanthraquinone via bromination using molecular bromine and nitric acid as a co-reagent.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 2 |
| RTECS | CB6950000 |
| TSCA | TSCA listed |
| Storage Class | 4.1A - Other explosive hazardous materials |
