A6320612
1-Nitroanthraquinone , >98.0% , 82-34-8
CAS NO.：82-34-8
Empirical Formula: C14H7NO4
Molecular Weight: 253.21
MDL number: MFCD00019140
EINECS: 201-413-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.80 | In Stock |
|
| 5g | RMB89.60 | In Stock |
|
| 25G | RMB311.20 | In Stock |
|
| 100G | RMB890.40 | In Stock |
|
| 500G | RMB2872.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 232.5~233.5℃ |
| Boiling point: | 270~271℃(933Pa) |
| Density | 1.3146 (rough estimate) |
| refractive index | 1.4700 (estimate) |
| Flash point: | 243.3 ±18.5 ℃ |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| color | Light yellow to Brown |
| InChI | InChI=1S/C14H7NO4/c16-13-8-4-1-2-5-9(8)14(17)12-10(13)6-3-7-11(12)15(18)19/h1-7H |
| InChIKey | YCANAXVBJKNANM-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=C2C(C(=O)C3=C(C2=O)C=CC=C3)=CC=C1 |
| CAS DataBase Reference | 82-34-8(CAS DataBase Reference) |
| EPA Substance Registry System | 9,10-Anthracenedione, 1-nitro- (82-34-8) |
Description and Uses
1-Nitroanthraquinone is used in the manufacture of various dyes, pharmaceuticals and similar products, either directly or after reduction to l-aminoanthraquinone.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P305+P351+P338 |
| Risk Statements | 20/21/22 |
| Safety Statements | 22-36/37/39 |
| RTECS | CB7940000 |
| HS Code | 2914.69.9000 |
