PRODUCT Properties
| Melting point: | 318-322 °C (lit.) |
| Boiling point: | 563.4±50.0 °C(Predicted) |
| Density | 1.631±0.06 g/cm3(Predicted) |
| storage temp. | -20°C, Inert atmosphere |
| solubility | DMSO (Slightly, Heated, Sonicated), Methanol (Slightly) |
| form | Solid |
| color | Yellow |
| InChI | InChI=1S/C14H6N2O6/c17-13-7-3-1-5-9(15(19)20)11(7)14(18)12-8(13)4-2-6-10(12)16(21)22/h1-6H |
| InChIKey | MBIJFIUDKPXMAV-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=C2C(C(=O)C3=C(C2=O)C([N+]([O-])=O)=CC=C3)=CC=C1 |
| EPA Substance Registry System | 9,10-Anthracenedione, 1,8-dinitro- (129-39-5) |
Description and Uses
1,8-Dinitroanthracene-9,10-dione is used in preparation method of disperse dyes using 1-aminoanthraquinone DMF residue.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P271-P261-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2914790090 |
| Storage Class | 4.1A - Other explosive hazardous materials |
