S113378
Naphthalene-bis(hexachlorocyclopentadiene) adduct , 5696-92-4
Synonym(s):
DHA;NSC 122892
CAS NO.：5696-92-4
Empirical Formula: C20H8Cl12
Molecular Weight: 673.71
MDL number: MFCD00167975
EINECS: 227-171-6
| Pack Size | Price | Stock | Quantity |
| 500g | RMB875.91 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 208-210 °C(lit.) |
| Boiling point: | 688°C (rough estimate) |
| Density | 1.5401 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| form | solid |
| InChI | 1S/C20H8Cl12/c21-11-13(23)17(27)9-7(15(11,25)19(17,29)30)5-3-1-2-4-6(5)8-10(9)18(28)14(24)12(22)16(8,26)20(18,31)32/h1-4,7-10H/t7,8,9,10,15-,16+,17+,18- |
| InChIKey | ULBZLTIPWBXWCY-QDCKJYKTSA-N |
| SMILES | ClC1=C(Cl)[C@@]2(Cl)C3C(C4C(c5ccccc35)[C@@]6(Cl)C(Cl)=C(Cl)[C@]4(Cl)C6(Cl)Cl)[C@]1(Cl)C2(Cl)Cl |
| EPA Substance Registry System | 1,4:5,8-Dimethanotriphenylene, 1,2,3,4,5,6,7,8,13,13,14,14-dodecachloro-1,4,4a,4b,5,8,8a,12b-octahydro- (5696-92-4) |
Description and Uses
Reactant involved in iodination and retro Diels-alder reactions
Molecule studied for its pharmacological activity as a KSP inhibitor
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |