S118778
7-(Trifluoromethyl)quinoline-4-thiol , 95% , 64415-07-2
CAS NO.:64415-07-2
Empirical Formula: C10H6F3NS
Molecular Weight: 229.22
MDL number: MFCD00006780
EINECS: 264-875-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB675.62 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 222-225 °C (lit.) |
| Boiling point: | 307.8±37.0 °C(Predicted) |
| Density | 1.407±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, stored under nitrogen |
| pka | 0.39±0.30(Predicted) |
| form | chunks |
| Appearance | Light yellow to yellow Solid |
| InChI | InChI=1S/C10H6F3NS/c11-10(12,13)6-1-2-7-8(5-6)14-4-3-9(7)15/h1-5H,(H,14,15) |
| InChIKey | DBWDEWRMEKXOFI-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=C(C(F)(F)F)C=2)C(S)=CC=1 |
Description and Uses
7-(Trifluoromethyl)quinoline-4-thiol was used to investigate the mechanism of generation of lipid-poor particles from high-density lipoprotein induced by cholesteryl ester transfer protein.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933499090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



