S1314516
≥98%(HPLC),solid , 78080-27-0
Synonym(s):
β-Phenyl-1,N2-ethenoguanosine 3′,5′-monophosphate sodium salt
CAS NO.:78080-27-0
Empirical Formula: C18H15N5NaO7P
Molecular Weight: 467.3
MDL number: MFCD04118064
| Pack Size | Price | Stock | Quantity |
| 1VIAL | RMB7349.64 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 932.4±75.0 °C(Predicted) |
| Density | 2.06±0.1 g/cm3(Predicted) |
| storage temp. | -70°C |
| solubility | H2O: ~10 mmol |
| form | solid |
| pka | 1.05±0.60(Predicted) |
| color | white |
| Water Solubility | H2O: ~10mmol |
| InChIKey | IGIOCJJIGJLGKR-TZNCIMHNSA-M |
| SMILES | [Na+].O[C@@H]1[C@@H]2OP([O-])(=O)OC[C@H]2O[C@H]1n3cnc4C(=O)N5C=C(NC5=Nc34)c6ccccc6 |
Description and Uses
PET-cGMP is a cyclic guanosine monophosphate analog and an effective selective agonist of PKG I, the EC50 of PET-cGMP for PKG Iβ is 3.8 nM, while for PKG II, it's 193 nM[1].
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |





