S145078
3-(Perfluorobutyryl)-(+)-camphor , 96% , 51800-99-8
Synonym(s):
(+)-3-(Heptafluorobutyryl)-(+)-camphor;3-(Perfluorobutyryl)-D -camphor
CAS NO.:51800-99-8
Empirical Formula: C14H15F7O2
Molecular Weight: 348.26
MDL number: MFCD00064154
EINECS: 257-430-9
| Pack Size | Price | Stock | Quantity |
| 5g | RMB1332.26 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 60-70 °C0.2 mm Hg(lit.) |
| Density | 1.218 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 201 °F |
| pka | 7.94±0.60(Predicted) |
| color | light yellow |
| optical activity | [α]20/D +125°, c = 2.6 in chloroform |
| BRN | 2306496 |
| InChI | 1S/C14H15F7O2/c1-10(2)6-4-5-11(10,3)8(22)7(6)9(23)12(15,16)13(17,18)14(19,20)21/h6-7H,4-5H2,1-3H3/t6-,7?,11+/m1/s1 |
| InChIKey | PEWOESYEGLBLNR-XGLFCGLISA-N |
| SMILES | CC1(C)C2CC[C@@]1(C)C(=O)C2C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 51800-99-8(CAS DataBase Reference) |
| EPA Substance Registry System | (1R,4R)-3-(Heptafluorobutyryl)-camphor (51800-99-8) |
Description and Uses
3-(Perfluorobutyryl)-(+)-camphor can be used:
- As a ligand in the synthesis of chiral europium complex for optoelectronic and photonic applications.
- As a ligand in the preparation of sodium tetrakis(3-heptafluorobutylryl-(+)-camphorato) Ln(III) complexes applicable as chemical sensors and NMR shift reagents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






