S148179
Triethoxy-3-(2-imidazolin-1-yl)propylsilane , ≥97.0%(NT) , 58068-97-6
Synonym(s):
1-(3-Triethoxysilylpropyl)-2-imidazoline;3-(2-Imidazolin-1-yl)propyltriethoxysilane
CAS NO.:58068-97-6
Empirical Formula: C12H26N2O3Si
Molecular Weight: 274.43
MDL number: MFCD00042997
EINECS: 261-093-3
| Pack Size | Price | Stock | Quantity |
| 10ML | RMB595.66 | In Stock |
|
| 50ML | RMB1590.34 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <0°C |
| Boiling point: | 134 °C |
| Density | 1.005 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | >110°C |
| storage temp. | Store at room temperature |
| pka | 11.26±0.20(Predicted) |
| Specific Gravity | 1.005 |
| Appearance | Colorless to light yellow Liquid |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 8987333 |
| InChI | InChI=1S/C12H26N2O3Si/c1-4-15-18(16-5-2,17-6-3)11-7-9-14-10-8-13-12-14/h12H,4-11H2,1-3H3 |
| InChIKey | WBUSESIMOZDSHU-UHFFFAOYSA-N |
| SMILES | C1N(CCC[Si](OCC)(OCC)OCC)CCN=1 |
| EPA Substance Registry System | 1H-Imidazole, 4,5-dihydro-1-[3-(triethoxysilyl)propyl]- (58068-97-6) |
Description and Uses
Additive for inorganic modification of block copolymers
Catalyst for condensation reactions
Modifier for organically modified layered silicates
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312-H315 |
| Precautionary statements | P264-P270-P280-P301+P312-P302+P352+P312-P332+P313 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3267 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral Skin Irrit. 2 |



![N-[3-(Trimethoxysilyl)propyl]ethylenediamine](https://img.chemicalbook.com/CAS/GIF/1760-24-3.gif)

